C28H38FNO6S2 — CID 146268803
3-[[3,3-dibutyl-1,1-dihydroxy-5-(4-methoxyphenyl)-7-methylsulfanyl-2,4-dihydro-1λ4,5-benzothiazepin-8-yl]oxy]-2-fluoroprop-2-enoic acid (PubChem CID 146268803) has the molecular formula C28H38FNO6S2 and a molecular weight of 567.75 g/mol. Its IUPAC name is 3-[[3,3-dibutyl-1,1-dihydroxy-5-(4-methoxyphenyl)-7-methylsulfanyl-2,4-dihydro-1λ4,5-benzothiazepin-8-yl]oxy]-2-fluoroprop-2-enoic acid.
| Compound Name | 3-[[3,3-dibutyl-1,1-dihydroxy-5-(4-methoxyphenyl)-7-methylsulfanyl-2,4-dihydro-1λ4,5-benzothiazepin-8-yl]oxy]-2-fluoroprop-2-enoic acid |
|---|---|
| PubChem CID | 146268803 |
| Molecular Formula | C28H38FNO6S2 |
| Molecular Weight | 567.75 g/mol |
| Exact Mass | 567.21 |
| IUPAC Name | 3-[[3,3-dibutyl-1,1-dihydroxy-5-(4-methoxyphenyl)-7-methylsulfanyl-2,4-dihydro-1λ4,5-benzothiazepin-8-yl]oxy]-2-fluoroprop-2-enoic acid |
| SMILES | CCCCC1(CCCC)CN(c2ccc(OC)cc2)c2cc(SC)c(OC=C(F)C(=O)O)cc2S(O)(O)C1 |
| InChI | InChI=1S/C28H38FNO6S2/c1-5-7-13-28(14-8-6-2)18-30(20-9-11-21(35-3)12-10-20)23-15-25(37-4)24(36-17-22(29)27(31)32)16-26(23)38(33,34)19-28/h9-12,15-17,33-34H,5-8,13-14,18-19H2,1-4H3,(H,31,32) |
| InChIKey | XWESGVRIAIHHTM-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.75 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|