C51H99O7P3 — CID 146268963
1,3-bis(8-octylphosphanyloctanoyloxy)propan-2-yl 8-[3-(pentylphosphanylmethyl)oxiran-2-yl]octanoate (PubChem CID 146268963) has the molecular formula C51H99O7P3 and a molecular weight of 917.27 g/mol. Its IUPAC name is 1,3-bis(8-octylphosphanyloctanoyloxy)propan-2-yl 8-[3-(pentylphosphanylmethyl)oxiran-2-yl]octanoate.
| Compound Name | 1,3-bis(8-octylphosphanyloctanoyloxy)propan-2-yl 8-[3-(pentylphosphanylmethyl)oxiran-2-yl]octanoate |
|---|---|
| PubChem CID | 146268963 |
| Molecular Formula | C51H99O7P3 |
| Molecular Weight | 917.27 g/mol |
| Exact Mass | 916.66 |
| IUPAC Name | 1,3-bis(8-octylphosphanyloctanoyloxy)propan-2-yl 8-[3-(pentylphosphanylmethyl)oxiran-2-yl]octanoate |
| SMILES | CCCCCCCCPCCCCCCCC(=O)OCC(COC(=O)CCCCCCCPCCCCCCCC)OC(=O)CCCCCCCC1OC1CPCCCCC |
| InChI | InChI=1S/C51H99O7P3/c1-4-7-10-12-21-30-38-59-40-32-23-15-19-26-35-49(52)55-43-46(44-56-50(53)36-27-20-16-24-33-41-60-39-31-22-13-11-8-5-2)57-51(54)37-28-18-14-17-25-34-47-48(58-47)45-61-42-29-9-6-3/h46-48,59-61H,4-45H2,1-3H3 |
| InChIKey | QNGVGROLSOAYGH-UHFFFAOYSA-N |
| XLogP | 15.11 |
| TPSA | 91.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 917.27 |
| LogP ≤ 5 | 15.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|