C19H15F5N2OS — CID 146268985
2-(5-cyclopropyl-3-ethylsulfanyl-2-pyridinyl)-5-(1,1,2,2,2-pentafluoroethyl)-1,3-benzoxazole (PubChem CID 146268985) has the molecular formula C19H15F5N2OS and a molecular weight of 414.40 g/mol. Its IUPAC name is 2-(5-cyclopropyl-3-ethylsulfanyl-2-pyridinyl)-5-(1,1,2,2,2-pentafluoroethyl)-1,3-benzoxazole.
| Compound Name | 2-(5-cyclopropyl-3-ethylsulfanyl-2-pyridinyl)-5-(1,1,2,2,2-pentafluoroethyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 146268985 |
| Molecular Formula | C19H15F5N2OS |
| Molecular Weight | 414.40 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | 2-(5-cyclopropyl-3-ethylsulfanyl-2-pyridinyl)-5-(1,1,2,2,2-pentafluoroethyl)-1,3-benzoxazole |
| SMILES | CCSc1cc(C2CC2)cnc1-c1nc2cc(C(F)(F)C(F)(F)F)ccc2o1 |
| InChI | InChI=1S/C19H15F5N2OS/c1-2-28-15-7-11(10-3-4-10)9-25-16(15)17-26-13-8-12(5-6-14(13)27-17)18(20,21)19(22,23)24/h5-10H,2-4H2,1H3 |
| InChIKey | ABMKQHGPEHUEFV-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.40 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|