C10H3F7O2 — CID 14626963
2,2,2-trifluoro-1-(2,2,3,3-tetrafluoro-1-benzofuran-5-yl)ethanone (PubChem CID 14626963) has the molecular formula C10H3F7O2 and a molecular weight of 288.12 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(2,2,3,3-tetrafluoro-1-benzofuran-5-yl)ethanone.
| Compound Name | 2,2,2-trifluoro-1-(2,2,3,3-tetrafluoro-1-benzofuran-5-yl)ethanone |
|---|---|
| PubChem CID | 14626963 |
| Molecular Formula | C10H3F7O2 |
| Molecular Weight | 288.12 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | 2,2,2-trifluoro-1-(2,2,3,3-tetrafluoro-1-benzofuran-5-yl)ethanone |
| SMILES | O=C(c1ccc2c(c1)C(F)(F)C(F)(F)O2)C(F)(F)F |
| InChI | InChI=1S/C10H3F7O2/c11-8(12)5-3-4(7(18)9(13,14)15)1-2-6(5)19-10(8,16)17/h1-3H |
| InChIKey | JAKAMGHYWXRWKK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.12 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|