C16H14N6OS — CID 146270334
2-[[4-amino-6-(1,2-thiazol-3-yl)pyrazolo[3,4-d]pyrimidin-2-yl]methyl]-4-methylphenol (PubChem CID 146270334) has the molecular formula C16H14N6OS and a molecular weight of 338.40 g/mol. Its IUPAC name is 2-[[4-amino-6-(1,2-thiazol-3-yl)pyrazolo[3,4-d]pyrimidin-2-yl]methyl]-4-methylphenol.
| Compound Name | 2-[[4-amino-6-(1,2-thiazol-3-yl)pyrazolo[3,4-d]pyrimidin-2-yl]methyl]-4-methylphenol |
|---|---|
| PubChem CID | 146270334 |
| Molecular Formula | C16H14N6OS |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 2-[[4-amino-6-(1,2-thiazol-3-yl)pyrazolo[3,4-d]pyrimidin-2-yl]methyl]-4-methylphenol |
| SMILES | Cc1ccc(O)c(Cn2cc3c(N)nc(-c4ccsn4)nc3n2)c1 |
| InChI | InChI=1S/C16H14N6OS/c1-9-2-3-13(23)10(6-9)7-22-8-11-14(17)18-16(19-15(11)20-22)12-4-5-24-21-12/h2-6,8,23H,7H2,1H3,(H2,17,18,19,20) |
| InChIKey | JBUYCDVMECGFJT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|