C15H23N3O — CID 146270504
3-[(2Z,4Z)-2-[(Z)-2-aminoprop-1-enyl]-4-methylhexa-2,4-dienyl]-5-methylidenepiperazin-2-one (PubChem CID 146270504) has the molecular formula C15H23N3O and a molecular weight of 261.37 g/mol. Its IUPAC name is 3-[(2Z,4Z)-2-[(Z)-2-aminoprop-1-enyl]-4-methylhexa-2,4-dienyl]-5-methylidenepiperazin-2-one.
| Compound Name | 3-[(2Z,4Z)-2-[(Z)-2-aminoprop-1-enyl]-4-methylhexa-2,4-dienyl]-5-methylidenepiperazin-2-one |
|---|---|
| PubChem CID | 146270504 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | 3-[(2Z,4Z)-2-[(Z)-2-aminoprop-1-enyl]-4-methylhexa-2,4-dienyl]-5-methylidenepiperazin-2-one |
| SMILES | C=C1CNC(=O)C(CC(/C=C(/C)N)=C/C(C)=C\C)N1 |
| InChI | InChI=1S/C15H23N3O/c1-5-10(2)6-13(7-11(3)16)8-14-15(19)17-9-12(4)18-14/h5-7,14,18H,4,8-9,16H2,1-3H3,(H,17,19)/b10-5-,11-7-,13-6+ |
| InChIKey | UFDNAEFVEXTAFK-HBEDWGJASA-N |
| XLogP | 1.73 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|