C22H21FN4O2 — CID 146270834
5-(7-fluoro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-2-morpholin-4-yl-1,3-benzoxazole (PubChem CID 146270834) has the molecular formula C22H21FN4O2 and a molecular weight of 392.43 g/mol. Its IUPAC name is 5-(7-fluoro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-2-morpholin-4-yl-1,3-benzoxazole.
| Compound Name | 5-(7-fluoro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-2-morpholin-4-yl-1,3-benzoxazole |
|---|---|
| PubChem CID | 146270834 |
| Molecular Formula | C22H21FN4O2 |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 5-(7-fluoro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-2-morpholin-4-yl-1,3-benzoxazole |
| SMILES | Fc1ccc2c3c([nH]c2c1)CN(c1ccc2oc(N4CCOCC4)nc2c1)CC3 |
| InChI | InChI=1S/C22H21FN4O2/c23-14-1-3-16-17-5-6-27(13-20(17)24-18(16)11-14)15-2-4-21-19(12-15)25-22(29-21)26-7-9-28-10-8-26/h1-4,11-12,24H,5-10,13H2 |
| InChIKey | VWVGVSUZUBEWAO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|