About N-(3-aminoprop-1-en-2-yl)-N'-methylethanimidamide
N-(3-aminoprop-1-en-2-yl)-N'-methylethanimidamide (PubChem CID 146270867) has the molecular formula C6H13N3
and a molecular weight of 127.19 g/mol. Its IUPAC name is N-(3-aminoprop-1-en-2-yl)-N'-methylethanimidamide.
Molecular Properties
| Compound Name | N-(3-aminoprop-1-en-2-yl)-N'-methylethanimidamide |
| PubChem CID | 146270867 |
| Molecular Formula | C6H13N3 |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.11 |
| IUPAC Name | N-(3-aminoprop-1-en-2-yl)-N'-methylethanimidamide |
| SMILES | C=C(CN)N/C(C)=N/C |
| InChI | InChI=1S/C6H13N3/c1-5(4-7)9-6(2)8-3/h1,4,7H2,2-3H3,(H,8,9) |
| InChIKey | BYGCYWHESVUFIK-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(3-aminoprop-1-en-2-yl)-N'-methylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-aminoprop-1-en-2-yl)-N'-methylethanimidamide?
The IUPAC name of N-(3-aminoprop-1-en-2-yl)-N'-methylethanimidamide (CID 146270867) is N-(3-aminoprop-1-en-2-yl)-N'-methylethanimidamide.
What is the SMILES notation for N-(3-aminoprop-1-en-2-yl)-N'-methylethanimidamide?
The canonical SMILES for N-(3-aminoprop-1-en-2-yl)-N'-methylethanimidamide is C=C(CN)N/C(C)=N/C.
What is the InChIKey of N-(3-aminoprop-1-en-2-yl)-N'-methylethanimidamide?
The InChIKey is BYGCYWHESVUFIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N3/c1-5(4-7)9-6(2)8-3/h1,4,7H2,2-3H3,(H,8,9).
What are the key properties of N-(3-aminoprop-1-en-2-yl)-N'-methylethanimidamide?
N-(3-aminoprop-1-en-2-yl)-N'-methylethanimidamide has a molecular weight of 127.19 g/mol, XLogP of 0.10, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-aminoprop-1-en-2-yl)-N'-methylethanimidamide is sourced from PubChem (CID 146270867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).