C25H24N4O3 — CID 146271330
N-[2-[[3-[(3,5-dimethoxyphenyl)methyl]-1H-pyrrolo[2,3-b]pyridin-6-yl]amino]phenyl]prop-2-enamide (PubChem CID 146271330) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is N-[2-[[3-[(3,5-dimethoxyphenyl)methyl]-1H-pyrrolo[2,3-b]pyridin-6-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[2-[[3-[(3,5-dimethoxyphenyl)methyl]-1H-pyrrolo[2,3-b]pyridin-6-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 146271330 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | N-[2-[[3-[(3,5-dimethoxyphenyl)methyl]-1H-pyrrolo[2,3-b]pyridin-6-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccccc1Nc1ccc2c(Cc3cc(OC)cc(OC)c3)c[nH]c2n1 |
| InChI | InChI=1S/C25H24N4O3/c1-4-24(30)28-22-8-6-5-7-21(22)27-23-10-9-20-17(15-26-25(20)29-23)11-16-12-18(31-2)14-19(13-16)32-3/h4-10,12-15H,1,11H2,2-3H3,(H,28,30)(H2,26,27,29) |
| InChIKey | MAEVFKDDSHTHJT-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|