C12H15F9O — CID 146271582
4-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-1,1-dimethylcyclohexane (PubChem CID 146271582) has the molecular formula C12H15F9O and a molecular weight of 346.23 g/mol. Its IUPAC name is 4-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-1,1-dimethylcyclohexane.
| Compound Name | 4-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-1,1-dimethylcyclohexane |
|---|---|
| PubChem CID | 146271582 |
| Molecular Formula | C12H15F9O |
| Molecular Weight | 346.23 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 4-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-1,1-dimethylcyclohexane |
| SMILES | CC1(C)CCC(OC(C(F)(F)F)(C(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H15F9O/c1-8(2)5-3-7(4-6-8)22-9(10(13,14)15,11(16,17)18)12(19,20)21/h7H,3-6H2,1-2H3 |
| InChIKey | LRIUUABRPHJIGB-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.23 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |