About 3-butyl-3-ethyl-7-fluoro-5-phenyl-2,4-dihydro-1,5-benzothiazepin-8-ol
3-butyl-3-ethyl-7-fluoro-5-phenyl-2,4-dihydro-1,5-benzothiazepin-8-ol (PubChem CID 146271929) has the molecular formula C21H26FNOS
and a molecular weight of 359.51 g/mol. Its IUPAC name is 3-butyl-3-ethyl-7-fluoro-5-phenyl-2,4-dihydro-1,5-benzothiazepin-8-ol.
Molecular Properties
| Compound Name | 3-butyl-3-ethyl-7-fluoro-5-phenyl-2,4-dihydro-1,5-benzothiazepin-8-ol |
| PubChem CID | 146271929 |
| Molecular Formula | C21H26FNOS |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 3-butyl-3-ethyl-7-fluoro-5-phenyl-2,4-dihydro-1,5-benzothiazepin-8-ol |
| SMILES | CCCCC1(CC)CSc2cc(O)c(F)cc2N(c2ccccc2)C1 |
| InChI | InChI=1S/C21H26FNOS/c1-3-5-11-21(4-2)14-23(16-9-7-6-8-10-16)18-12-17(22)19(24)13-20(18)25-15-21/h6-10,12-13,24H,3-5,11,14-15H2,1-2H3 |
| InChIKey | YEHAYFURQVMASZ-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-butyl-3-ethyl-7-fluoro-5-phenyl-2,4-dihydro-1,5-benzothiazepin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-3-ethyl-7-fluoro-5-phenyl-2,4-dihydro-1,5-benzothiazepin-8-ol?
The IUPAC name of 3-butyl-3-ethyl-7-fluoro-5-phenyl-2,4-dihydro-1,5-benzothiazepin-8-ol (CID 146271929) is 3-butyl-3-ethyl-7-fluoro-5-phenyl-2,4-dihydro-1,5-benzothiazepin-8-ol.
What is the SMILES notation for 3-butyl-3-ethyl-7-fluoro-5-phenyl-2,4-dihydro-1,5-benzothiazepin-8-ol?
The canonical SMILES for 3-butyl-3-ethyl-7-fluoro-5-phenyl-2,4-dihydro-1,5-benzothiazepin-8-ol is CCCCC1(CC)CSc2cc(O)c(F)cc2N(c2ccccc2)C1.
What is the InChIKey of 3-butyl-3-ethyl-7-fluoro-5-phenyl-2,4-dihydro-1,5-benzothiazepin-8-ol?
The InChIKey is YEHAYFURQVMASZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26FNOS/c1-3-5-11-21(4-2)14-23(16-9-7-6-8-10-16)18-12-17(22)19(24)13-20(18)25-15-21/h6-10,12-13,24H,3-5,11,14-15H2,1-2H3.
What are the key properties of 3-butyl-3-ethyl-7-fluoro-5-phenyl-2,4-dihydro-1,5-benzothiazepin-8-ol?
3-butyl-3-ethyl-7-fluoro-5-phenyl-2,4-dihydro-1,5-benzothiazepin-8-ol has a molecular weight of 359.51 g/mol, XLogP of 6.36, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-3-ethyl-7-fluoro-5-phenyl-2,4-dihydro-1,5-benzothiazepin-8-ol is sourced from PubChem (CID 146271929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).