C20H13F4N3O — CID 146272185
3-[(2,3,5,6-tetrafluoro-4-phenylanilino)methyl]-1H-pyrazolo[1,5-a]pyridin-2-one (PubChem CID 146272185) has the molecular formula C20H13F4N3O and a molecular weight of 387.34 g/mol. Its IUPAC name is 3-[(2,3,5,6-tetrafluoro-4-phenylanilino)methyl]-1H-pyrazolo[1,5-a]pyridin-2-one.
| Compound Name | 3-[(2,3,5,6-tetrafluoro-4-phenylanilino)methyl]-1H-pyrazolo[1,5-a]pyridin-2-one |
|---|---|
| PubChem CID | 146272185 |
| Molecular Formula | C20H13F4N3O |
| Molecular Weight | 387.34 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 3-[(2,3,5,6-tetrafluoro-4-phenylanilino)methyl]-1H-pyrazolo[1,5-a]pyridin-2-one |
| SMILES | O=c1[nH]n2ccccc2c1CNc1c(F)c(F)c(-c2ccccc2)c(F)c1F |
| InChI | InChI=1S/C20H13F4N3O/c21-15-14(11-6-2-1-3-7-11)16(22)18(24)19(17(15)23)25-10-12-13-8-4-5-9-27(13)26-20(12)28/h1-9,25H,10H2,(H,26,28) |
| InChIKey | JTYQJGBTNSWVEO-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 49.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.34 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|