C18H15ClN6O2 — CID 146273099
2-[[3-(6-chloro-3-pyridinyl)-5-methyl-1,2-oxazol-4-yl]methyl]-5-(1-methylpyrazol-4-yl)pyridazin-3-one (PubChem CID 146273099) has the molecular formula C18H15ClN6O2 and a molecular weight of 382.81 g/mol. Its IUPAC name is 2-[[3-(6-chloro-3-pyridinyl)-5-methyl-1,2-oxazol-4-yl]methyl]-5-(1-methylpyrazol-4-yl)pyridazin-3-one.
| Compound Name | 2-[[3-(6-chloro-3-pyridinyl)-5-methyl-1,2-oxazol-4-yl]methyl]-5-(1-methylpyrazol-4-yl)pyridazin-3-one |
|---|---|
| PubChem CID | 146273099 |
| Molecular Formula | C18H15ClN6O2 |
| Molecular Weight | 382.81 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 2-[[3-(6-chloro-3-pyridinyl)-5-methyl-1,2-oxazol-4-yl]methyl]-5-(1-methylpyrazol-4-yl)pyridazin-3-one |
| SMILES | Cc1onc(-c2ccc(Cl)nc2)c1Cn1ncc(-c2cnn(C)c2)cc1=O |
| InChI | InChI=1S/C18H15ClN6O2/c1-11-15(18(23-27-11)12-3-4-16(19)20-6-12)10-25-17(26)5-13(7-22-25)14-8-21-24(2)9-14/h3-9H,10H2,1-2H3 |
| InChIKey | RQXIDBRKHVHKSG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 91.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.81 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|