C33H29N3O7 — CID 146273931
(5S)-5-ethyl-5-hydroxy-14-[(E)-2-(4-morpholin-4-ylphenyl)ethenyl]-7,18,20-trioxa-11,24-diazahexacyclo[11.11.0.02,11.04,9.015,23.017,21]tetracosa-1(24),2,4(9),13,15,17(21),22-heptaene-6,10-dione (PubChem CID 146273931) has the molecular formula C33H29N3O7 and a molecular weight of 579.61 g/mol. Its IUPAC name is (5S)-5-ethyl-5-hydroxy-14-[(E)-2-(4-morpholin-4-ylphenyl)ethenyl]-7,18,20-trioxa-11,24-diazahexacyclo[11.11.0.02,11.04,9.015,23.017,21]tetracosa-1(24),2,4(9),13,15,17(21),22-heptaene-6,10-dione.
| Compound Name | (5S)-5-ethyl-5-hydroxy-14-[(E)-2-(4-morpholin-4-ylphenyl)ethenyl]-7,18,20-trioxa-11,24-diazahexacyclo[11.11.0.02,11.04,9.015,23.017,21]tetracosa-1(24),2,4(9),13,15,17(21),22-heptaene-6,10-dione |
|---|---|
| PubChem CID | 146273931 |
| Molecular Formula | C33H29N3O7 |
| Molecular Weight | 579.61 g/mol |
| Exact Mass | 579.20 |
| IUPAC Name | (5S)-5-ethyl-5-hydroxy-14-[(E)-2-(4-morpholin-4-ylphenyl)ethenyl]-7,18,20-trioxa-11,24-diazahexacyclo[11.11.0.02,11.04,9.015,23.017,21]tetracosa-1(24),2,4(9),13,15,17(21),22-heptaene-6,10-dione |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1cc3c(cc1c2/C=C/c1ccc(N2CCOCC2)cc1)OCO3 |
| InChI | InChI=1S/C33H29N3O7/c1-2-33(39)25-14-27-30-23(16-36(27)31(37)24(25)17-41-32(33)38)21(22-13-28-29(43-18-42-28)15-26(22)34-30)8-5-19-3-6-20(7-4-19)35-9-11-40-12-10-35/h3-8,13-15,39H,2,9-12,16-18H2,1H3/b8-5+/t33-/m0/s1 |
| InChIKey | RNPKYEIANPNNPX-GBMFXBNPSA-N |
| XLogP | 3.82 |
| TPSA | 112.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.61 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|