C34H34F2N4O3 — CID 146274011
benzyl 3-[4-[1-[[4-[[4-(1,1-difluoroethyl)phenyl]methyl]-2,3-dihydropyrido[4,3-b][1,4]oxazin-5-yl]amino]ethyl]phenyl]-3-oxopropanimidate (PubChem CID 146274011) has the molecular formula C34H34F2N4O3 and a molecular weight of 584.67 g/mol. Its IUPAC name is benzyl 3-[4-[1-[[4-[[4-(1,1-difluoroethyl)phenyl]methyl]-2,3-dihydropyrido[4,3-b][1,4]oxazin-5-yl]amino]ethyl]phenyl]-3-oxopropanimidate.
| Compound Name | benzyl 3-[4-[1-[[4-[[4-(1,1-difluoroethyl)phenyl]methyl]-2,3-dihydropyrido[4,3-b][1,4]oxazin-5-yl]amino]ethyl]phenyl]-3-oxopropanimidate |
|---|---|
| PubChem CID | 146274011 |
| Molecular Formula | C34H34F2N4O3 |
| Molecular Weight | 584.67 g/mol |
| Exact Mass | 584.26 |
| IUPAC Name | benzyl 3-[4-[1-[[4-[[4-(1,1-difluoroethyl)phenyl]methyl]-2,3-dihydropyrido[4,3-b][1,4]oxazin-5-yl]amino]ethyl]phenyl]-3-oxopropanimidate |
| SMILES | [H]/N=C(/CC(=O)c1ccc(C(C)Nc2nccc3c2N(Cc2ccc(C(C)(F)F)cc2)CCO3)cc1)OCc1ccccc1 |
| InChI | InChI=1S/C34H34F2N4O3/c1-23(26-10-12-27(13-11-26)29(41)20-31(37)43-22-25-6-4-3-5-7-25)39-33-32-30(16-17-38-33)42-19-18-40(32)21-24-8-14-28(15-9-24)34(2,35)36/h3-17,23,37H,18-22H2,1-2H3,(H,38,39)/b37-31- |
| InChIKey | DPINSZCPXWQLEN-OXKNFPIISA-N |
| XLogP | 7.53 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.67 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|