C26H28ClN3O — CID 146274031
1-[4-[1-[[1-[2-(3-chlorophenyl)ethyl]-3,4-dihydro-2H-1,7-naphthyridin-8-yl]amino]ethyl]phenyl]ethenol (PubChem CID 146274031) has the molecular formula C26H28ClN3O and a molecular weight of 433.98 g/mol. Its IUPAC name is 1-[4-[1-[[1-[2-(3-chlorophenyl)ethyl]-3,4-dihydro-2H-1,7-naphthyridin-8-yl]amino]ethyl]phenyl]ethenol.
| Compound Name | 1-[4-[1-[[1-[2-(3-chlorophenyl)ethyl]-3,4-dihydro-2H-1,7-naphthyridin-8-yl]amino]ethyl]phenyl]ethenol |
|---|---|
| PubChem CID | 146274031 |
| Molecular Formula | C26H28ClN3O |
| Molecular Weight | 433.98 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 1-[4-[1-[[1-[2-(3-chlorophenyl)ethyl]-3,4-dihydro-2H-1,7-naphthyridin-8-yl]amino]ethyl]phenyl]ethenol |
| SMILES | C=C(O)c1ccc(C(C)Nc2nccc3c2N(CCc2cccc(Cl)c2)CCC3)cc1 |
| InChI | InChI=1S/C26H28ClN3O/c1-18(21-8-10-22(11-9-21)19(2)31)29-26-25-23(12-14-28-26)6-4-15-30(25)16-13-20-5-3-7-24(27)17-20/h3,5,7-12,14,17-18,31H,2,4,6,13,15-16H2,1H3,(H,28,29) |
| InChIKey | MAQIJPBDAUSVJS-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.98 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|