C19H25F2N7O — CID 146274132
[2-(azepan-3-ylamino)pyrrolo[1,2-b]pyridazin-7-yl]-[[3-(difluoromethyl)-1-methylpyrazol-4-yl]amino]methanol (PubChem CID 146274132) has the molecular formula C19H25F2N7O and a molecular weight of 405.45 g/mol. Its IUPAC name is [2-(azepan-3-ylamino)pyrrolo[1,2-b]pyridazin-7-yl]-[[3-(difluoromethyl)-1-methylpyrazol-4-yl]amino]methanol.
| Compound Name | [2-(azepan-3-ylamino)pyrrolo[1,2-b]pyridazin-7-yl]-[[3-(difluoromethyl)-1-methylpyrazol-4-yl]amino]methanol |
|---|---|
| PubChem CID | 146274132 |
| Molecular Formula | C19H25F2N7O |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | [2-(azepan-3-ylamino)pyrrolo[1,2-b]pyridazin-7-yl]-[[3-(difluoromethyl)-1-methylpyrazol-4-yl]amino]methanol |
| SMILES | Cn1cc(NC(O)c2ccc3ccc(NC4CCCCNC4)nn23)c(C(F)F)n1 |
| InChI | InChI=1S/C19H25F2N7O/c1-27-11-14(17(26-27)18(20)21)24-19(29)15-7-5-13-6-8-16(25-28(13)15)23-12-4-2-3-9-22-10-12/h5-8,11-12,18-19,22,24,29H,2-4,9-10H2,1H3,(H,23,25) |
| InChIKey | UIWQSFWJXMQHOZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 91.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|