About 1-(4-iodopiperazin-1-yl)-4-methoxy-2,4-dimethylpentan-2-amine
1-(4-iodopiperazin-1-yl)-4-methoxy-2,4-dimethylpentan-2-amine (PubChem CID 146274281) has the molecular formula C12H26IN3O
and a molecular weight of 355.26 g/mol. Its IUPAC name is 1-(4-iodopiperazin-1-yl)-4-methoxy-2,4-dimethylpentan-2-amine.
Molecular Properties
| Compound Name | 1-(4-iodopiperazin-1-yl)-4-methoxy-2,4-dimethylpentan-2-amine |
| PubChem CID | 146274281 |
| Molecular Formula | C12H26IN3O |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 1-(4-iodopiperazin-1-yl)-4-methoxy-2,4-dimethylpentan-2-amine |
| SMILES | COC(C)(C)CC(C)(N)CN1CCN(I)CC1 |
| InChI | InChI=1S/C12H26IN3O/c1-11(2,17-4)9-12(3,14)10-15-5-7-16(13)8-6-15/h5-10,14H2,1-4H3 |
| InChIKey | NODQUEUVYWVVKU-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-iodopiperazin-1-yl)-4-methoxy-2,4-dimethylpentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-iodopiperazin-1-yl)-4-methoxy-2,4-dimethylpentan-2-amine?
The IUPAC name of 1-(4-iodopiperazin-1-yl)-4-methoxy-2,4-dimethylpentan-2-amine (CID 146274281) is 1-(4-iodopiperazin-1-yl)-4-methoxy-2,4-dimethylpentan-2-amine.
What is the SMILES notation for 1-(4-iodopiperazin-1-yl)-4-methoxy-2,4-dimethylpentan-2-amine?
The canonical SMILES for 1-(4-iodopiperazin-1-yl)-4-methoxy-2,4-dimethylpentan-2-amine is COC(C)(C)CC(C)(N)CN1CCN(I)CC1.
What is the InChIKey of 1-(4-iodopiperazin-1-yl)-4-methoxy-2,4-dimethylpentan-2-amine?
The InChIKey is NODQUEUVYWVVKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26IN3O/c1-11(2,17-4)9-12(3,14)10-15-5-7-16(13)8-6-15/h5-10,14H2,1-4H3.
What are the key properties of 1-(4-iodopiperazin-1-yl)-4-methoxy-2,4-dimethylpentan-2-amine?
1-(4-iodopiperazin-1-yl)-4-methoxy-2,4-dimethylpentan-2-amine has a molecular weight of 355.26 g/mol, XLogP of 1.49, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-iodopiperazin-1-yl)-4-methoxy-2,4-dimethylpentan-2-amine is sourced from PubChem (CID 146274281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).