About 1-iodo-4-(4-methoxy-2,2,4-trimethylpentyl)piperazine
1-iodo-4-(4-methoxy-2,2,4-trimethylpentyl)piperazine (PubChem CID 146274310) has the molecular formula C13H27IN2O
and a molecular weight of 354.28 g/mol. Its IUPAC name is 1-iodo-4-(4-methoxy-2,2,4-trimethylpentyl)piperazine.
Molecular Properties
| Compound Name | 1-iodo-4-(4-methoxy-2,2,4-trimethylpentyl)piperazine |
| PubChem CID | 146274310 |
| Molecular Formula | C13H27IN2O |
| Molecular Weight | 354.28 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 1-iodo-4-(4-methoxy-2,2,4-trimethylpentyl)piperazine |
| SMILES | COC(C)(C)CC(C)(C)CN1CCN(I)CC1 |
| InChI | InChI=1S/C13H27IN2O/c1-12(2,10-13(3,4)17-5)11-15-6-8-16(14)9-7-15/h6-11H2,1-5H3 |
| InChIKey | PGAQCYDCGBPUOS-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-iodo-4-(4-methoxy-2,2,4-trimethylpentyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodo-4-(4-methoxy-2,2,4-trimethylpentyl)piperazine?
The IUPAC name of 1-iodo-4-(4-methoxy-2,2,4-trimethylpentyl)piperazine (CID 146274310) is 1-iodo-4-(4-methoxy-2,2,4-trimethylpentyl)piperazine.
What is the SMILES notation for 1-iodo-4-(4-methoxy-2,2,4-trimethylpentyl)piperazine?
The canonical SMILES for 1-iodo-4-(4-methoxy-2,2,4-trimethylpentyl)piperazine is COC(C)(C)CC(C)(C)CN1CCN(I)CC1.
What is the InChIKey of 1-iodo-4-(4-methoxy-2,2,4-trimethylpentyl)piperazine?
The InChIKey is PGAQCYDCGBPUOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27IN2O/c1-12(2,10-13(3,4)17-5)11-15-6-8-16(14)9-7-15/h6-11H2,1-5H3.
What are the key properties of 1-iodo-4-(4-methoxy-2,2,4-trimethylpentyl)piperazine?
1-iodo-4-(4-methoxy-2,2,4-trimethylpentyl)piperazine has a molecular weight of 354.28 g/mol, XLogP of 2.80, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodo-4-(4-methoxy-2,2,4-trimethylpentyl)piperazine is sourced from PubChem (CID 146274310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).