About 1-[4-(5,6-dihydro-1H-indol-3-yl)cyclohexa-1,5-dien-1-yl]ethanimine
1-[4-(5,6-dihydro-1H-indol-3-yl)cyclohexa-1,5-dien-1-yl]ethanimine (PubChem CID 146275666) has the molecular formula C16H18N2
and a molecular weight of 238.33 g/mol. Its IUPAC name is 1-[4-(5,6-dihydro-1H-indol-3-yl)cyclohexa-1,5-dien-1-yl]ethanimine.
Molecular Properties
| Compound Name | 1-[4-(5,6-dihydro-1H-indol-3-yl)cyclohexa-1,5-dien-1-yl]ethanimine |
| PubChem CID | 146275666 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 1-[4-(5,6-dihydro-1H-indol-3-yl)cyclohexa-1,5-dien-1-yl]ethanimine |
| SMILES | [H]/N=C(\C)C1=CCC(c2c[nH]c3c2=CCCC=3)C=C1 |
| InChI | InChI=1S/C16H18N2/c1-11(17)12-6-8-13(9-7-12)15-10-18-16-5-3-2-4-14(15)16/h4-8,10,13,17-18H,2-3,9H2,1H3/b17-11+ |
| InChIKey | GWFDBQOCUJMSDC-GZTJUZNOSA-N |
| XLogP | 2.38 |
| TPSA | 39.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(5,6-dihydro-1H-indol-3-yl)cyclohexa-1,5-dien-1-yl]ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(5,6-dihydro-1H-indol-3-yl)cyclohexa-1,5-dien-1-yl]ethanimine?
The IUPAC name of 1-[4-(5,6-dihydro-1H-indol-3-yl)cyclohexa-1,5-dien-1-yl]ethanimine (CID 146275666) is 1-[4-(5,6-dihydro-1H-indol-3-yl)cyclohexa-1,5-dien-1-yl]ethanimine.
What is the SMILES notation for 1-[4-(5,6-dihydro-1H-indol-3-yl)cyclohexa-1,5-dien-1-yl]ethanimine?
The canonical SMILES for 1-[4-(5,6-dihydro-1H-indol-3-yl)cyclohexa-1,5-dien-1-yl]ethanimine is [H]/N=C(\C)C1=CCC(c2c[nH]c3c2=CCCC=3)C=C1.
What is the InChIKey of 1-[4-(5,6-dihydro-1H-indol-3-yl)cyclohexa-1,5-dien-1-yl]ethanimine?
The InChIKey is GWFDBQOCUJMSDC-GZTJUZNOSA-N. The full InChI is InChI=1S/C16H18N2/c1-11(17)12-6-8-13(9-7-12)15-10-18-16-5-3-2-4-14(15)16/h4-8,10,13,17-18H,2-3,9H2,1H3/b17-11+.
What are the key properties of 1-[4-(5,6-dihydro-1H-indol-3-yl)cyclohexa-1,5-dien-1-yl]ethanimine?
1-[4-(5,6-dihydro-1H-indol-3-yl)cyclohexa-1,5-dien-1-yl]ethanimine has a molecular weight of 238.33 g/mol, XLogP of 2.38, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(5,6-dihydro-1H-indol-3-yl)cyclohexa-1,5-dien-1-yl]ethanimine is sourced from PubChem (CID 146275666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).