C16H29NO — CID 146275949
(2R,3R,5Z,7E)-3-ethyl-8-methoxy-N,N,2-trimethyl-4-methylidenenona-5,7-dien-1-amine (PubChem CID 146275949) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is (2R,3R,5Z,7E)-3-ethyl-8-methoxy-N,N,2-trimethyl-4-methylidenenona-5,7-dien-1-amine.
| Compound Name | (2R,3R,5Z,7E)-3-ethyl-8-methoxy-N,N,2-trimethyl-4-methylidenenona-5,7-dien-1-amine |
|---|---|
| PubChem CID | 146275949 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | (2R,3R,5Z,7E)-3-ethyl-8-methoxy-N,N,2-trimethyl-4-methylidenenona-5,7-dien-1-amine |
| SMILES | C=C(/C=C\C=C(/C)OC)[C@H](CC)[C@@H](C)CN(C)C |
| InChI | InChI=1S/C16H29NO/c1-8-16(14(3)12-17(5)6)13(2)10-9-11-15(4)18-7/h9-11,14,16H,2,8,12H2,1,3-7H3/b10-9-,15-11+/t14-,16-/m0/s1 |
| InChIKey | INHNNEJHCQOWBR-SNRAKTFCSA-N |
| XLogP | 3.87 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|