C26H32O10 — CID 146276560
diethyl 2-[[(2R,3S,4R)-3-acetyloxy-3-(2-cyclopropylethynyl)-4,5-dihydroxyoxolan-2-yl]methoxy]-2-benzylpropanedioate (PubChem CID 146276560) has the molecular formula C26H32O10 and a molecular weight of 504.53 g/mol. Its IUPAC name is diethyl 2-[[(2R,3S,4R)-3-acetyloxy-3-(2-cyclopropylethynyl)-4,5-dihydroxyoxolan-2-yl]methoxy]-2-benzylpropanedioate.
| Compound Name | diethyl 2-[[(2R,3S,4R)-3-acetyloxy-3-(2-cyclopropylethynyl)-4,5-dihydroxyoxolan-2-yl]methoxy]-2-benzylpropanedioate |
|---|---|
| PubChem CID | 146276560 |
| Molecular Formula | C26H32O10 |
| Molecular Weight | 504.53 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | diethyl 2-[[(2R,3S,4R)-3-acetyloxy-3-(2-cyclopropylethynyl)-4,5-dihydroxyoxolan-2-yl]methoxy]-2-benzylpropanedioate |
| SMILES | CCOC(=O)C(Cc1ccccc1)(OC[C@H]1OC(O)[C@H](O)[C@]1(C#CC1CC1)OC(C)=O)C(=O)OCC |
| InChI | InChI=1S/C26H32O10/c1-4-32-23(30)26(24(31)33-5-2,15-19-9-7-6-8-10-19)34-16-20-25(36-17(3)27,14-13-18-11-12-18)21(28)22(29)35-20/h6-10,18,20-22,28-29H,4-5,11-12,15-16H2,1-3H3/t20-,21+,22?,25-/m1/s1 |
| InChIKey | FSKGHQAQKMTJQC-SRGAATOTSA-N |
| XLogP | 0.90 |
| TPSA | 137.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.53 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|