C27H34O12 — CID 146276564
diethyl 2-benzyl-2-[[(2R,3R,4R)-3,4,5-triacetyloxy-3-ethenyloxolan-2-yl]methoxy]propanedioate (PubChem CID 146276564) has the molecular formula C27H34O12 and a molecular weight of 550.56 g/mol. Its IUPAC name is diethyl 2-benzyl-2-[[(2R,3R,4R)-3,4,5-triacetyloxy-3-ethenyloxolan-2-yl]methoxy]propanedioate.
| Compound Name | diethyl 2-benzyl-2-[[(2R,3R,4R)-3,4,5-triacetyloxy-3-ethenyloxolan-2-yl]methoxy]propanedioate |
|---|---|
| PubChem CID | 146276564 |
| Molecular Formula | C27H34O12 |
| Molecular Weight | 550.56 g/mol |
| Exact Mass | 550.21 |
| IUPAC Name | diethyl 2-benzyl-2-[[(2R,3R,4R)-3,4,5-triacetyloxy-3-ethenyloxolan-2-yl]methoxy]propanedioate |
| SMILES | C=C[C@@]1(OC(C)=O)[C@@H](COC(Cc2ccccc2)(C(=O)OCC)C(=O)OCC)OC(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C27H34O12/c1-7-26(39-19(6)30)21(38-23(37-18(5)29)22(26)36-17(4)28)16-35-27(24(31)33-8-2,25(32)34-9-3)15-20-13-11-10-12-14-20/h7,10-14,21-23H,1,8-9,15-16H2,2-6H3/t21-,22+,23?,26-/m1/s1 |
| InChIKey | KMKVBJBCCDFCKE-SLJHHMTISA-N |
| XLogP | 1.82 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.56 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|