C28H32O12 — CID 146276585
1-O-ethyl 3-O-[(Z)-prop-1-enyl] 2-benzyl-2-[[(2R,3R,4R)-3,4,5-triacetyloxy-3-ethynyloxolan-2-yl]methoxy]propanedioate (PubChem CID 146276585) has the molecular formula C28H32O12 and a molecular weight of 560.55 g/mol. Its IUPAC name is 1-O-ethyl 3-O-[(Z)-prop-1-enyl] 2-benzyl-2-[[(2R,3R,4R)-3,4,5-triacetyloxy-3-ethynyloxolan-2-yl]methoxy]propanedioate.
| Compound Name | 1-O-ethyl 3-O-[(Z)-prop-1-enyl] 2-benzyl-2-[[(2R,3R,4R)-3,4,5-triacetyloxy-3-ethynyloxolan-2-yl]methoxy]propanedioate |
|---|---|
| PubChem CID | 146276585 |
| Molecular Formula | C28H32O12 |
| Molecular Weight | 560.55 g/mol |
| Exact Mass | 560.19 |
| IUPAC Name | 1-O-ethyl 3-O-[(Z)-prop-1-enyl] 2-benzyl-2-[[(2R,3R,4R)-3,4,5-triacetyloxy-3-ethynyloxolan-2-yl]methoxy]propanedioate |
| SMILES | C#C[C@@]1(OC(C)=O)[C@@H](COC(Cc2ccccc2)(C(=O)O/C=C\C)C(=O)OCC)OC(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C28H32O12/c1-7-15-35-26(33)28(25(32)34-9-3,16-21-13-11-10-12-14-21)36-17-22-27(8-2,40-20(6)31)23(37-18(4)29)24(39-22)38-19(5)30/h2,7,10-15,22-24H,9,16-17H2,1,3-6H3/b15-7-/t22-,23+,24?,27-,28?/m1/s1 |
| InChIKey | FIYQIJMYLQYBND-ISYAUFMXSA-N |
| XLogP | 1.78 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.55 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|