C26H21ClN4O8S — CID 146276596
2-benzyl-2-[[(2R,3S,4R,5R)-5-(2-chloro-6-thiophen-2-ylpurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]propanedioic acid (PubChem CID 146276596) has the molecular formula C26H21ClN4O8S and a molecular weight of 584.99 g/mol. Its IUPAC name is 2-benzyl-2-[[(2R,3S,4R,5R)-5-(2-chloro-6-thiophen-2-ylpurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]propanedioic acid.
| Compound Name | 2-benzyl-2-[[(2R,3S,4R,5R)-5-(2-chloro-6-thiophen-2-ylpurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]propanedioic acid |
|---|---|
| PubChem CID | 146276596 |
| Molecular Formula | C26H21ClN4O8S |
| Molecular Weight | 584.99 g/mol |
| Exact Mass | 584.08 |
| IUPAC Name | 2-benzyl-2-[[(2R,3S,4R,5R)-5-(2-chloro-6-thiophen-2-ylpurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]propanedioic acid |
| SMILES | C#C[C@@]1(O)[C@@H](COC(Cc2ccccc2)(C(=O)O)C(=O)O)O[C@@H](n2cnc3c(-c4cccs4)nc(Cl)nc32)[C@@H]1O |
| InChI | InChI=1S/C26H21ClN4O8S/c1-2-25(37)16(12-38-26(22(33)34,23(35)36)11-14-7-4-3-5-8-14)39-21(19(25)32)31-13-28-18-17(15-9-6-10-40-15)29-24(27)30-20(18)31/h1,3-10,13,16,19,21,32,37H,11-12H2,(H,33,34)(H,35,36)/t16-,19+,21-,25-/m1/s1 |
| InChIKey | IFQKBJYYRNUQKC-RAOAOTKRSA-N |
| XLogP | 2.00 |
| TPSA | 177.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.99 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|