C29H24ClN5O10 — CID 146276605
2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-2-[[4-(2-carboxyphenyl)phenyl]methyl]propanedioic acid (PubChem CID 146276605) has the molecular formula C29H24ClN5O10 and a molecular weight of 637.99 g/mol. Its IUPAC name is 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-2-[[4-(2-carboxyphenyl)phenyl]methyl]propanedioic acid.
| Compound Name | 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-2-[[4-(2-carboxyphenyl)phenyl]methyl]propanedioic acid |
|---|---|
| PubChem CID | 146276605 |
| Molecular Formula | C29H24ClN5O10 |
| Molecular Weight | 637.99 g/mol |
| Exact Mass | 637.12 |
| IUPAC Name | 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-2-[[4-(2-carboxyphenyl)phenyl]methyl]propanedioic acid |
| SMILES | C#C[C@@]1(O)[C@@H](COC(Cc2ccc(-c3ccccc3C(=O)O)cc2)(C(=O)O)C(=O)O)O[C@@H](n2cnc3c(N)nc(Cl)nc32)[C@@H]1O |
| InChI | InChI=1S/C29H24ClN5O10/c1-2-28(43)18(45-23(20(28)36)35-13-32-19-21(31)33-27(30)34-22(19)35)12-44-29(25(39)40,26(41)42)11-14-7-9-15(10-8-14)16-5-3-4-6-17(16)24(37)38/h1,3-10,13,18,20,23,36,43H,11-12H2,(H,37,38)(H,39,40)(H,41,42)(H2,31,33,34)/t18-,20+,23-,28-/m1/s1 |
| InChIKey | PAMYAJPNOYQWCX-MSBWPPHFSA-N |
| XLogP | 1.22 |
| TPSA | 240.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.99 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|