C27H27ClN6O9 — CID 146276697
2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-2-[[4-(2-oxopiperidin-1-yl)phenyl]methyl]propanedioic acid (PubChem CID 146276697) has the molecular formula C27H27ClN6O9 and a molecular weight of 615.00 g/mol. Its IUPAC name is 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-2-[[4-(2-oxopiperidin-1-yl)phenyl]methyl]propanedioic acid.
| Compound Name | 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-2-[[4-(2-oxopiperidin-1-yl)phenyl]methyl]propanedioic acid |
|---|---|
| PubChem CID | 146276697 |
| Molecular Formula | C27H27ClN6O9 |
| Molecular Weight | 615.00 g/mol |
| Exact Mass | 614.15 |
| IUPAC Name | 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy]-2-[[4-(2-oxopiperidin-1-yl)phenyl]methyl]propanedioic acid |
| SMILES | C#C[C@@]1(O)[C@@H](COC(Cc2ccc(N3CCCCC3=O)cc2)(C(=O)O)C(=O)O)O[C@@H](n2cnc3c(N)nc(Cl)nc32)[C@@H]1O |
| InChI | InChI=1S/C27H27ClN6O9/c1-2-26(41)16(43-22(19(26)36)34-13-30-18-20(29)31-25(28)32-21(18)34)12-42-27(23(37)38,24(39)40)11-14-6-8-15(9-7-14)33-10-4-3-5-17(33)35/h1,6-9,13,16,19,22,36,41H,3-5,10-12H2,(H,37,38)(H,39,40)(H2,29,31,32)/t16-,19+,22-,26-/m1/s1 |
| InChIKey | IYGQBVNFUKBANX-AZTDZYQASA-N |
| XLogP | 0.37 |
| TPSA | 223.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.00 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|