C25H24ClN5O8 — CID 146276710
2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3-(2-cyclopropylethynyl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-benzylpropanedioic acid (PubChem CID 146276710) has the molecular formula C25H24ClN5O8 and a molecular weight of 557.95 g/mol. Its IUPAC name is 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3-(2-cyclopropylethynyl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-benzylpropanedioic acid.
| Compound Name | 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3-(2-cyclopropylethynyl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-benzylpropanedioic acid |
|---|---|
| PubChem CID | 146276710 |
| Molecular Formula | C25H24ClN5O8 |
| Molecular Weight | 557.95 g/mol |
| Exact Mass | 557.13 |
| IUPAC Name | 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3-(2-cyclopropylethynyl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-benzylpropanedioic acid |
| SMILES | Nc1nc(Cl)nc2c1ncn2[C@@H]1O[C@H](COC(Cc2ccccc2)(C(=O)O)C(=O)O)[C@](O)(C#CC2CC2)[C@H]1O |
| InChI | InChI=1S/C25H24ClN5O8/c26-23-29-18(27)16-19(30-23)31(12-28-16)20-17(32)24(37,9-8-13-6-7-13)15(39-20)11-38-25(21(33)34,22(35)36)10-14-4-2-1-3-5-14/h1-5,12-13,15,17,20,32,37H,6-7,10-11H2,(H,33,34)(H,35,36)(H2,27,29,30)/t15-,17+,20-,24-/m1/s1 |
| InChIKey | ROSUSDOWZHLRHL-PEFNEFTPSA-N |
| XLogP | 0.63 |
| TPSA | 203.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.95 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|