C23H22ClN5O8 — CID 146276891
2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxy-3-prop-1-ynyloxolan-2-yl]methoxy]-2-benzylpropanedioic acid (PubChem CID 146276891) has the molecular formula C23H22ClN5O8 and a molecular weight of 531.91 g/mol. Its IUPAC name is 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxy-3-prop-1-ynyloxolan-2-yl]methoxy]-2-benzylpropanedioic acid.
| Compound Name | 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxy-3-prop-1-ynyloxolan-2-yl]methoxy]-2-benzylpropanedioic acid |
|---|---|
| PubChem CID | 146276891 |
| Molecular Formula | C23H22ClN5O8 |
| Molecular Weight | 531.91 g/mol |
| Exact Mass | 531.12 |
| IUPAC Name | 2-[[(2R,3S,4R,5R)-5-(6-amino-2-chloropurin-9-yl)-3,4-dihydroxy-3-prop-1-ynyloxolan-2-yl]methoxy]-2-benzylpropanedioic acid |
| SMILES | CC#C[C@@]1(O)[C@@H](COC(Cc2ccccc2)(C(=O)O)C(=O)O)O[C@@H](n2cnc3c(N)nc(Cl)nc32)[C@@H]1O |
| InChI | InChI=1S/C23H22ClN5O8/c1-2-8-22(35)13(10-36-23(19(31)32,20(33)34)9-12-6-4-3-5-7-12)37-18(15(22)30)29-11-26-14-16(25)27-21(24)28-17(14)29/h3-7,11,13,15,18,30,35H,9-10H2,1H3,(H,31,32)(H,33,34)(H2,25,27,28)/t13-,15+,18-,22-/m1/s1 |
| InChIKey | LMTQJHIRBXSJII-UUTQCIBDSA-N |
| XLogP | 0.24 |
| TPSA | 203.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.91 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|