About N-(2-fluorophenyl)-1,3-thiazole-2-carbothioamide
N-(2-fluorophenyl)-1,3-thiazole-2-carbothioamide (PubChem CID 146277086) has the molecular formula C10H7FN2S2
and a molecular weight of 238.31 g/mol. Its IUPAC name is N-(2-fluorophenyl)-1,3-thiazole-2-carbothioamide.
Molecular Properties
| Compound Name | N-(2-fluorophenyl)-1,3-thiazole-2-carbothioamide |
| PubChem CID | 146277086 |
| Molecular Formula | C10H7FN2S2 |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.00 |
| IUPAC Name | N-(2-fluorophenyl)-1,3-thiazole-2-carbothioamide |
| SMILES | Fc1ccccc1NC(=S)c1nccs1 |
| InChI | InChI=1S/C10H7FN2S2/c11-7-3-1-2-4-8(7)13-9(14)10-12-5-6-15-10/h1-6H,(H,13,14) |
| InChIKey | QCENJJZCCUVFOU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-(2-fluorophenyl)-1,3-thiazole-2-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-fluorophenyl)-1,3-thiazole-2-carbothioamide?
The IUPAC name of N-(2-fluorophenyl)-1,3-thiazole-2-carbothioamide (CID 146277086) is N-(2-fluorophenyl)-1,3-thiazole-2-carbothioamide.
What is the SMILES notation for N-(2-fluorophenyl)-1,3-thiazole-2-carbothioamide?
The canonical SMILES for N-(2-fluorophenyl)-1,3-thiazole-2-carbothioamide is Fc1ccccc1NC(=S)c1nccs1.
What is the InChIKey of N-(2-fluorophenyl)-1,3-thiazole-2-carbothioamide?
The InChIKey is QCENJJZCCUVFOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7FN2S2/c11-7-3-1-2-4-8(7)13-9(14)10-12-5-6-15-10/h1-6H,(H,13,14).
What are the key properties of N-(2-fluorophenyl)-1,3-thiazole-2-carbothioamide?
N-(2-fluorophenyl)-1,3-thiazole-2-carbothioamide has a molecular weight of 238.31 g/mol, XLogP of 3.07, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-fluorophenyl)-1,3-thiazole-2-carbothioamide is sourced from PubChem (CID 146277086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).