C13H16N4O3S — CID 14627721
1-(7-hydroxy-6,6-dimethyl-7,8-dihydropyrano[2,3-f][2,1,3]benzoxadiazol-8-yl)-3-methylthiourea (PubChem CID 14627721) has the molecular formula C13H16N4O3S and a molecular weight of 308.36 g/mol. Its IUPAC name is 1-(7-hydroxy-6,6-dimethyl-7,8-dihydropyrano[2,3-f][2,1,3]benzoxadiazol-8-yl)-3-methylthiourea.
| Compound Name | 1-(7-hydroxy-6,6-dimethyl-7,8-dihydropyrano[2,3-f][2,1,3]benzoxadiazol-8-yl)-3-methylthiourea |
|---|---|
| PubChem CID | 14627721 |
| Molecular Formula | C13H16N4O3S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 1-(7-hydroxy-6,6-dimethyl-7,8-dihydropyrano[2,3-f][2,1,3]benzoxadiazol-8-yl)-3-methylthiourea |
| SMILES | CNC(=S)NC1c2cc3nonc3cc2OC(C)(C)C1O |
| InChI | InChI=1S/C13H16N4O3S/c1-13(2)11(18)10(15-12(21)14-3)6-4-7-8(17-20-16-7)5-9(6)19-13/h4-5,10-11,18H,1-3H3,(H2,14,15,21) |
| InChIKey | CHDAIFPNHZFXET-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 92.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|