C14H18N4O5 — CID 14627732
ethyl N-[(7-hydroxy-6,6-dimethyl-7,8-dihydropyrano[2,3-f][2,1,3]benzoxadiazol-8-yl)amino]carbamate (PubChem CID 14627732) has the molecular formula C14H18N4O5 and a molecular weight of 322.32 g/mol. Its IUPAC name is ethyl N-[(7-hydroxy-6,6-dimethyl-7,8-dihydropyrano[2,3-f][2,1,3]benzoxadiazol-8-yl)amino]carbamate.
| Compound Name | ethyl N-[(7-hydroxy-6,6-dimethyl-7,8-dihydropyrano[2,3-f][2,1,3]benzoxadiazol-8-yl)amino]carbamate |
|---|---|
| PubChem CID | 14627732 |
| Molecular Formula | C14H18N4O5 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | ethyl N-[(7-hydroxy-6,6-dimethyl-7,8-dihydropyrano[2,3-f][2,1,3]benzoxadiazol-8-yl)amino]carbamate |
| SMILES | CCOC(=O)NNC1c2cc3nonc3cc2OC(C)(C)C1O |
| InChI | InChI=1S/C14H18N4O5/c1-4-21-13(20)16-15-11-7-5-8-9(18-23-17-8)6-10(7)22-14(2,3)12(11)19/h5-6,11-12,15,19H,4H2,1-3H3,(H,16,20) |
| InChIKey | BSLOFANGTGGDAE-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 118.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|