C23H34O — CID 146278013
6-[(E)-1-(3,7-dimethyloct-6-enoxy)prop-1-en-2-yl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 146278013) has the molecular formula C23H34O and a molecular weight of 326.52 g/mol. Its IUPAC name is 6-[(E)-1-(3,7-dimethyloct-6-enoxy)prop-1-en-2-yl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-[(E)-1-(3,7-dimethyloct-6-enoxy)prop-1-en-2-yl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 146278013 |
| Molecular Formula | C23H34O |
| Molecular Weight | 326.52 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | 6-[(E)-1-(3,7-dimethyloct-6-enoxy)prop-1-en-2-yl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | CC(C)=CCCC(C)CCO/C=C(\C)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C23H34O/c1-18(2)8-7-9-19(3)14-15-24-17-20(4)22-13-12-21-10-5-6-11-23(21)16-22/h8,12-13,16-17,19H,5-7,9-11,14-15H2,1-4H3/b20-17+ |
| InChIKey | WEWBULGHIBJXHH-LVZFUZTISA-N |
| XLogP | 6.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.52 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|