C24H26FN7O2S — CID 146278686
(5S)-2-(cyclopropanecarbonylamino)-N-(cyclopropylmethyl)-5-[3-[(2-fluoro-3-pyridinyl)amino]-1,2,4-triazol-4-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 146278686) has the molecular formula C24H26FN7O2S and a molecular weight of 495.58 g/mol. Its IUPAC name is (5S)-2-(cyclopropanecarbonylamino)-N-(cyclopropylmethyl)-5-[3-[(2-fluoro-3-pyridinyl)amino]-1,2,4-triazol-4-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (5S)-2-(cyclopropanecarbonylamino)-N-(cyclopropylmethyl)-5-[3-[(2-fluoro-3-pyridinyl)amino]-1,2,4-triazol-4-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 146278686 |
| Molecular Formula | C24H26FN7O2S |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | (5S)-2-(cyclopropanecarbonylamino)-N-(cyclopropylmethyl)-5-[3-[(2-fluoro-3-pyridinyl)amino]-1,2,4-triazol-4-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | O=C(NCC1CC1)c1c(NC(=O)C2CC2)sc2c1C[C@@H](n1cnnc1Nc1cccnc1F)CC2 |
| InChI | InChI=1S/C24H26FN7O2S/c25-20-17(2-1-9-26-20)29-24-31-28-12-32(24)15-7-8-18-16(10-15)19(22(34)27-11-13-3-4-13)23(35-18)30-21(33)14-5-6-14/h1-2,9,12-15H,3-8,10-11H2,(H,27,34)(H,29,31)(H,30,33)/t15-/m0/s1 |
| InChIKey | YEBRDVORDBVOFT-HNNXBMFYSA-N |
| XLogP | 3.84 |
| TPSA | 113.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|