About pyrazol-1-yl 3-oxo-1H-isoindole-2-carboxylate
pyrazol-1-yl 3-oxo-1H-isoindole-2-carboxylate (PubChem CID 146279459) has the molecular formula C12H9N3O3
and a molecular weight of 243.22 g/mol. Its IUPAC name is pyrazol-1-yl 3-oxo-1H-isoindole-2-carboxylate.
Molecular Properties
| Compound Name | pyrazol-1-yl 3-oxo-1H-isoindole-2-carboxylate |
| PubChem CID | 146279459 |
| Molecular Formula | C12H9N3O3 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | pyrazol-1-yl 3-oxo-1H-isoindole-2-carboxylate |
| SMILES | O=C(On1cccn1)N1Cc2ccccc2C1=O |
| InChI | InChI=1S/C12H9N3O3/c16-11-10-5-2-1-4-9(10)8-14(11)12(17)18-15-7-3-6-13-15/h1-7H,8H2 |
| InChIKey | XSNPAMISDCOSHW-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze pyrazol-1-yl 3-oxo-1H-isoindole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrazol-1-yl 3-oxo-1H-isoindole-2-carboxylate?
The IUPAC name of pyrazol-1-yl 3-oxo-1H-isoindole-2-carboxylate (CID 146279459) is pyrazol-1-yl 3-oxo-1H-isoindole-2-carboxylate.
What is the SMILES notation for pyrazol-1-yl 3-oxo-1H-isoindole-2-carboxylate?
The canonical SMILES for pyrazol-1-yl 3-oxo-1H-isoindole-2-carboxylate is O=C(On1cccn1)N1Cc2ccccc2C1=O.
What is the InChIKey of pyrazol-1-yl 3-oxo-1H-isoindole-2-carboxylate?
The InChIKey is XSNPAMISDCOSHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N3O3/c16-11-10-5-2-1-4-9(10)8-14(11)12(17)18-15-7-3-6-13-15/h1-7H,8H2.
What are the key properties of pyrazol-1-yl 3-oxo-1H-isoindole-2-carboxylate?
pyrazol-1-yl 3-oxo-1H-isoindole-2-carboxylate has a molecular weight of 243.22 g/mol, XLogP of 1.09, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pyrazol-1-yl 3-oxo-1H-isoindole-2-carboxylate is sourced from PubChem (CID 146279459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).