C18H19FN2 — CID 146279489
5-(4-fluoro-2-pyrrolidin-1-ylphenyl)-2,3-dihydro-1H-isoindole (PubChem CID 146279489) has the molecular formula C18H19FN2 and a molecular weight of 282.36 g/mol. Its IUPAC name is 5-(4-fluoro-2-pyrrolidin-1-ylphenyl)-2,3-dihydro-1H-isoindole.
| Compound Name | 5-(4-fluoro-2-pyrrolidin-1-ylphenyl)-2,3-dihydro-1H-isoindole |
|---|---|
| PubChem CID | 146279489 |
| Molecular Formula | C18H19FN2 |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 5-(4-fluoro-2-pyrrolidin-1-ylphenyl)-2,3-dihydro-1H-isoindole |
| SMILES | Fc1ccc(-c2ccc3c(c2)CNC3)c(N2CCCC2)c1 |
| InChI | InChI=1S/C18H19FN2/c19-16-5-6-17(18(10-16)21-7-1-2-8-21)13-3-4-14-11-20-12-15(14)9-13/h3-6,9-10,20H,1-2,7-8,11-12H2 |
| InChIKey | IQIKXGWBIZPMMT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |