C18H25NO5 — CID 146279937
2-[methyl-[[(1S,2S,4R,12S,13R)-4-methyl-14-oxo-3,15-dioxatricyclo[10.3.0.02,4]pentadec-8-yn-13-yl]methyl]amino]acetic acid (PubChem CID 146279937) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is 2-[methyl-[[(1S,2S,4R,12S,13R)-4-methyl-14-oxo-3,15-dioxatricyclo[10.3.0.02,4]pentadec-8-yn-13-yl]methyl]amino]acetic acid.
| Compound Name | 2-[methyl-[[(1S,2S,4R,12S,13R)-4-methyl-14-oxo-3,15-dioxatricyclo[10.3.0.02,4]pentadec-8-yn-13-yl]methyl]amino]acetic acid |
|---|---|
| PubChem CID | 146279937 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 2-[methyl-[[(1S,2S,4R,12S,13R)-4-methyl-14-oxo-3,15-dioxatricyclo[10.3.0.02,4]pentadec-8-yn-13-yl]methyl]amino]acetic acid |
| SMILES | CN(CC(=O)O)C[C@@H]1C(=O)O[C@H]2[C@H]1CCC#CCCC[C@@]1(C)O[C@@H]21 |
| InChI | InChI=1S/C18H25NO5/c1-18-9-7-5-3-4-6-8-12-13(10-19(2)11-14(20)21)17(22)23-15(12)16(18)24-18/h12-13,15-16H,5-11H2,1-2H3,(H,20,21)/t12-,13-,15-,16-,18+/m0/s1 |
| InChIKey | QIMFLFNXNMNXGQ-WSLKZVHASA-N |
| XLogP | 1.29 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|