C17H14Cl2N6O4 — CID 146279980
2-[3,5-dichloro-4-[[5-(1,1,1,3,3,3-hexadeuteriopropan-2-yl)-6-hydroxy-1,6-dihydropyridazin-3-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile (PubChem CID 146279980) has the molecular formula C17H14Cl2N6O4 and a molecular weight of 443.28 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[[5-(1,1,1,3,3,3-hexadeuteriopropan-2-yl)-6-hydroxy-1,6-dihydropyridazin-3-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile.
| Compound Name | 2-[3,5-dichloro-4-[[5-(1,1,1,3,3,3-hexadeuteriopropan-2-yl)-6-hydroxy-1,6-dihydropyridazin-3-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
|---|---|
| PubChem CID | 146279980 |
| Molecular Formula | C17H14Cl2N6O4 |
| Molecular Weight | 443.28 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | 2-[3,5-dichloro-4-[[5-(1,1,1,3,3,3-hexadeuteriopropan-2-yl)-6-hydroxy-1,6-dihydropyridazin-3-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
| SMILES | [2H]C([2H])([2H])C(C1=CC(Oc2c(Cl)cc(-n3nc(C#N)c(=O)[nH]c3=O)cc2Cl)=NNC1O)C([2H])([2H])[2H] |
| InChI | InChI=1S/C17H14Cl2N6O4/c1-7(2)9-5-13(22-23-15(9)26)29-14-10(18)3-8(4-11(14)19)25-17(28)21-16(27)12(6-20)24-25/h3-5,7,15,23,26H,1-2H3,(H,21,27,28)/i1D3,2D3 |
| InChIKey | LDIGFGXFVVVNCE-WFGJKAKNSA-N |
| XLogP | 1.30 |
| TPSA | 145.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |