C18H21N3 — CID 146280273
(3Z,5Z,8Z)-9-[(1Z)-buta-1,3-dienyl]-8-ethyl-1,7-dimethyl-2,7-dihydroazonine-5,6-dicarbonitrile (PubChem CID 146280273) has the molecular formula C18H21N3 and a molecular weight of 279.39 g/mol. Its IUPAC name is (3Z,5Z,8Z)-9-[(1Z)-buta-1,3-dienyl]-8-ethyl-1,7-dimethyl-2,7-dihydroazonine-5,6-dicarbonitrile.
| Compound Name | (3Z,5Z,8Z)-9-[(1Z)-buta-1,3-dienyl]-8-ethyl-1,7-dimethyl-2,7-dihydroazonine-5,6-dicarbonitrile |
|---|---|
| PubChem CID | 146280273 |
| Molecular Formula | C18H21N3 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | (3Z,5Z,8Z)-9-[(1Z)-buta-1,3-dienyl]-8-ethyl-1,7-dimethyl-2,7-dihydroazonine-5,6-dicarbonitrile |
| SMILES | C=C/C=C\C1=C(/CC)C(C)/C(C#N)=C(C#N)\C=C/CN1C |
| InChI | InChI=1S/C18H21N3/c1-5-7-10-18-16(6-2)14(3)17(13-20)15(12-19)9-8-11-21(18)4/h5,7-10,14H,1,6,11H2,2-4H3/b9-8-,10-7-,17-15+,18-16- |
| InChIKey | FZPBEKCYMVGDGT-IQDWXHJMSA-N |
| XLogP | 3.87 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|