C18H17N3 — CID 146280488
9-[(1E,3Z)-1-cyanohexa-1,3-dienyl]-7-methyl-7-azabicyclo[4.3.1]deca-2,4,6(10),8-tetraene-2-carbonitrile (PubChem CID 146280488) has the molecular formula C18H17N3 and a molecular weight of 275.36 g/mol. Its IUPAC name is 9-[(1E,3Z)-1-cyanohexa-1,3-dienyl]-7-methyl-7-azabicyclo[4.3.1]deca-2,4,6(10),8-tetraene-2-carbonitrile.
| Compound Name | 9-[(1E,3Z)-1-cyanohexa-1,3-dienyl]-7-methyl-7-azabicyclo[4.3.1]deca-2,4,6(10),8-tetraene-2-carbonitrile |
|---|---|
| PubChem CID | 146280488 |
| Molecular Formula | C18H17N3 |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 9-[(1E,3Z)-1-cyanohexa-1,3-dienyl]-7-methyl-7-azabicyclo[4.3.1]deca-2,4,6(10),8-tetraene-2-carbonitrile |
| SMILES | CC/C=C\C=C(\C#N)C1=CN(C)C2=CC1C(C#N)=CC=C2 |
| InChI | InChI=1S/C18H17N3/c1-3-4-5-7-15(12-20)18-13-21(2)16-9-6-8-14(11-19)17(18)10-16/h4-10,13,17H,3H2,1-2H3/b5-4-,15-7- |
| InChIKey | SCBDMVDAOSDBAL-NAOUQGLUSA-N |
| XLogP | 3.75 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|