C25H15Cl2FN2O4 — CID 146281373
(2E)-2-[5-(2,4-dichlorophenyl)-9-fluoro-9-methyl-3-oxo-7-oxa-2,6-diazapentacyclo[9.7.1.02,10.04,8.015,19]nonadeca-1(18),4(8),5,10,15(19),16-hexaen-14-ylidene]acetic acid (PubChem CID 146281373) has the molecular formula C25H15Cl2FN2O4 and a molecular weight of 497.31 g/mol. Its IUPAC name is (2E)-2-[5-(2,4-dichlorophenyl)-9-fluoro-9-methyl-3-oxo-7-oxa-2,6-diazapentacyclo[9.7.1.02,10.04,8.015,19]nonadeca-1(18),4(8),5,10,15(19),16-hexaen-14-ylidene]acetic acid.
| Compound Name | (2E)-2-[5-(2,4-dichlorophenyl)-9-fluoro-9-methyl-3-oxo-7-oxa-2,6-diazapentacyclo[9.7.1.02,10.04,8.015,19]nonadeca-1(18),4(8),5,10,15(19),16-hexaen-14-ylidene]acetic acid |
|---|---|
| PubChem CID | 146281373 |
| Molecular Formula | C25H15Cl2FN2O4 |
| Molecular Weight | 497.31 g/mol |
| Exact Mass | 496.04 |
| IUPAC Name | (2E)-2-[5-(2,4-dichlorophenyl)-9-fluoro-9-methyl-3-oxo-7-oxa-2,6-diazapentacyclo[9.7.1.02,10.04,8.015,19]nonadeca-1(18),4(8),5,10,15(19),16-hexaen-14-ylidene]acetic acid |
| SMILES | CC1(F)c2onc(-c3ccc(Cl)cc3Cl)c2C(=O)n2c1c1c3c(cccc32)/C(=C/C(=O)O)CC1 |
| InChI | InChI=1S/C25H15Cl2FN2O4/c1-25(28)22-15-7-5-11(9-18(31)32)13-3-2-4-17(19(13)15)30(22)24(33)20-21(29-34-23(20)25)14-8-6-12(26)10-16(14)27/h2-4,6,8-10H,5,7H2,1H3,(H,31,32)/b11-9+ |
| InChIKey | RGJVGIGIGDKIRS-PKNBQFBNSA-N |
| XLogP | 6.25 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.31 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|