About (4Z)-4-amino-3-methylidene-5-(2-methylphenyl)penta-1,4-dien-2-ol
(4Z)-4-amino-3-methylidene-5-(2-methylphenyl)penta-1,4-dien-2-ol (PubChem CID 146281426) has the molecular formula C13H15NO
and a molecular weight of 201.27 g/mol. Its IUPAC name is (4Z)-4-amino-3-methylidene-5-(2-methylphenyl)penta-1,4-dien-2-ol.
Molecular Properties
| Compound Name | (4Z)-4-amino-3-methylidene-5-(2-methylphenyl)penta-1,4-dien-2-ol |
| PubChem CID | 146281426 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | (4Z)-4-amino-3-methylidene-5-(2-methylphenyl)penta-1,4-dien-2-ol |
| SMILES | C=C(O)C(=C)/C(N)=C/c1ccccc1C |
| InChI | InChI=1S/C13H15NO/c1-9-6-4-5-7-12(9)8-13(14)10(2)11(3)15/h4-8,15H,2-3,14H2,1H3/b13-8- |
| InChIKey | ASTNHTHSSNMLCM-JYRVWZFOSA-N |
| XLogP | 2.92 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-4-amino-3-methylidene-5-(2-methylphenyl)penta-1,4-dien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4-amino-3-methylidene-5-(2-methylphenyl)penta-1,4-dien-2-ol?
The IUPAC name of (4Z)-4-amino-3-methylidene-5-(2-methylphenyl)penta-1,4-dien-2-ol (CID 146281426) is (4Z)-4-amino-3-methylidene-5-(2-methylphenyl)penta-1,4-dien-2-ol.
What is the SMILES notation for (4Z)-4-amino-3-methylidene-5-(2-methylphenyl)penta-1,4-dien-2-ol?
The canonical SMILES for (4Z)-4-amino-3-methylidene-5-(2-methylphenyl)penta-1,4-dien-2-ol is C=C(O)C(=C)/C(N)=C/c1ccccc1C.
What is the InChIKey of (4Z)-4-amino-3-methylidene-5-(2-methylphenyl)penta-1,4-dien-2-ol?
The InChIKey is ASTNHTHSSNMLCM-JYRVWZFOSA-N. The full InChI is InChI=1S/C13H15NO/c1-9-6-4-5-7-12(9)8-13(14)10(2)11(3)15/h4-8,15H,2-3,14H2,1H3/b13-8-.
What are the key properties of (4Z)-4-amino-3-methylidene-5-(2-methylphenyl)penta-1,4-dien-2-ol?
(4Z)-4-amino-3-methylidene-5-(2-methylphenyl)penta-1,4-dien-2-ol has a molecular weight of 201.27 g/mol, XLogP of 2.92, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4-amino-3-methylidene-5-(2-methylphenyl)penta-1,4-dien-2-ol is sourced from PubChem (CID 146281426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).