C17H10I2O5 — CID 146281800
5-[(4-hydroxy-3,5-diiodophenyl)methylidene]-2-phenyl-1,3-dioxane-4,6-dione (PubChem CID 146281800) has the molecular formula C17H10I2O5 and a molecular weight of 548.07 g/mol. Its IUPAC name is 5-[(4-hydroxy-3,5-diiodophenyl)methylidene]-2-phenyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(4-hydroxy-3,5-diiodophenyl)methylidene]-2-phenyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 146281800 |
| Molecular Formula | C17H10I2O5 |
| Molecular Weight | 548.07 g/mol |
| Exact Mass | 547.86 |
| IUPAC Name | 5-[(4-hydroxy-3,5-diiodophenyl)methylidene]-2-phenyl-1,3-dioxane-4,6-dione |
| SMILES | O=C1OC(c2ccccc2)OC(=O)C1=Cc1cc(I)c(O)c(I)c1 |
| InChI | InChI=1S/C17H10I2O5/c18-12-7-9(8-13(19)14(12)20)6-11-15(21)23-17(24-16(11)22)10-4-2-1-3-5-10/h1-8,17,20H/b11-6- |
| InChIKey | JLHFORXPPIZHJJ-WDZFZDKYSA-N |
| XLogP | 3.78 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.07 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|