About methane;(3R)-3-(3-methoxypropyl)-2-prop-2-enylcyclopentan-1-one
methane;(3R)-3-(3-methoxypropyl)-2-prop-2-enylcyclopentan-1-one (PubChem CID 146282537) has the molecular formula C13H24O2
and a molecular weight of 212.33 g/mol. Its IUPAC name is methane;(3R)-3-(3-methoxypropyl)-2-prop-2-enylcyclopentan-1-one.
Molecular Properties
| Compound Name | methane;(3R)-3-(3-methoxypropyl)-2-prop-2-enylcyclopentan-1-one |
| PubChem CID | 146282537 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | methane;(3R)-3-(3-methoxypropyl)-2-prop-2-enylcyclopentan-1-one |
| SMILES | C.C=CCC1C(=O)CC[C@H]1CCCOC |
| InChI | InChI=1S/C12H20O2.CH4/c1-3-5-11-10(6-4-9-14-2)7-8-12(11)13;/h3,10-11H,1,4-9H2,2H3;1H4/t10-,11?;/m1./s1 |
| InChIKey | QEFBDFQODSWIIL-QUUNXCOLSA-N |
| XLogP | 3.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methane;(3R)-3-(3-methoxypropyl)-2-prop-2-enylcyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;(3R)-3-(3-methoxypropyl)-2-prop-2-enylcyclopentan-1-one?
The IUPAC name of methane;(3R)-3-(3-methoxypropyl)-2-prop-2-enylcyclopentan-1-one (CID 146282537) is methane;(3R)-3-(3-methoxypropyl)-2-prop-2-enylcyclopentan-1-one.
What is the SMILES notation for methane;(3R)-3-(3-methoxypropyl)-2-prop-2-enylcyclopentan-1-one?
The canonical SMILES for methane;(3R)-3-(3-methoxypropyl)-2-prop-2-enylcyclopentan-1-one is C.C=CCC1C(=O)CC[C@H]1CCCOC.
What is the InChIKey of methane;(3R)-3-(3-methoxypropyl)-2-prop-2-enylcyclopentan-1-one?
The InChIKey is QEFBDFQODSWIIL-QUUNXCOLSA-N. The full InChI is InChI=1S/C12H20O2.CH4/c1-3-5-11-10(6-4-9-14-2)7-8-12(11)13;/h3,10-11H,1,4-9H2,2H3;1H4/t10-,11?;/m1./s1.
What are the key properties of methane;(3R)-3-(3-methoxypropyl)-2-prop-2-enylcyclopentan-1-one?
methane;(3R)-3-(3-methoxypropyl)-2-prop-2-enylcyclopentan-1-one has a molecular weight of 212.33 g/mol, XLogP of 3.22, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;(3R)-3-(3-methoxypropyl)-2-prop-2-enylcyclopentan-1-one is sourced from PubChem (CID 146282537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).