C10H15NO — CID 146282543
(3aR,4S,6aR)-4-prop-2-enyl-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-one (PubChem CID 146282543) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is (3aR,4S,6aR)-4-prop-2-enyl-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-one.
| Compound Name | (3aR,4S,6aR)-4-prop-2-enyl-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-one |
|---|---|
| PubChem CID | 146282543 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (3aR,4S,6aR)-4-prop-2-enyl-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-one |
| SMILES | C=CC[C@@H]1C(=O)C[C@H]2CNC[C@H]21 |
| InChI | InChI=1S/C10H15NO/c1-2-3-8-9-6-11-5-7(9)4-10(8)12/h2,7-9,11H,1,3-6H2/t7-,8-,9+/m0/s1 |
| InChIKey | RQBGYYZSHWDFNR-XHNCKOQMSA-N |
| XLogP | 0.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|