C18H27IN2O3 — CID 146282566
(1S,2S,3aS,6aR)-2-acetamido-N-(1-iodobutyl)-5-oxo-1-prop-2-enyl-1,3,3a,4,6,6a-hexahydropentalene-2-carboxamide (PubChem CID 146282566) has the molecular formula C18H27IN2O3 and a molecular weight of 446.33 g/mol. Its IUPAC name is (1S,2S,3aS,6aR)-2-acetamido-N-(1-iodobutyl)-5-oxo-1-prop-2-enyl-1,3,3a,4,6,6a-hexahydropentalene-2-carboxamide.
| Compound Name | (1S,2S,3aS,6aR)-2-acetamido-N-(1-iodobutyl)-5-oxo-1-prop-2-enyl-1,3,3a,4,6,6a-hexahydropentalene-2-carboxamide |
|---|---|
| PubChem CID | 146282566 |
| Molecular Formula | C18H27IN2O3 |
| Molecular Weight | 446.33 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | (1S,2S,3aS,6aR)-2-acetamido-N-(1-iodobutyl)-5-oxo-1-prop-2-enyl-1,3,3a,4,6,6a-hexahydropentalene-2-carboxamide |
| SMILES | C=CC[C@H]1[C@@H]2CC(=O)C[C@@H]2C[C@@]1(NC(C)=O)C(=O)NC(I)CCC |
| InChI | InChI=1S/C18H27IN2O3/c1-4-6-15-14-9-13(23)8-12(14)10-18(15,21-11(3)22)17(24)20-16(19)7-5-2/h4,12,14-16H,1,5-10H2,2-3H3,(H,20,24)(H,21,22)/t12-,14-,15+,16?,18+/m1/s1 |
| InChIKey | LMSXOADIFFOKBI-RFOFUXHYSA-N |
| XLogP | 2.73 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|