About 8-(cyclopropylmethylsulfonyl)-3-[(2-fluorophenyl)methyl]-1,7-dimethylpurine-2,6-dione
8-(cyclopropylmethylsulfonyl)-3-[(2-fluorophenyl)methyl]-1,7-dimethylpurine-2,6-dione (PubChem CID 146283011) has the molecular formula C18H19FN4O4S
and a molecular weight of 406.44 g/mol. Its IUPAC name is 8-(cyclopropylmethylsulfonyl)-3-[(2-fluorophenyl)methyl]-1,7-dimethylpurine-2,6-dione.
Molecular Properties
| Compound Name | 8-(cyclopropylmethylsulfonyl)-3-[(2-fluorophenyl)methyl]-1,7-dimethylpurine-2,6-dione |
| PubChem CID | 146283011 |
| Molecular Formula | C18H19FN4O4S |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 8-(cyclopropylmethylsulfonyl)-3-[(2-fluorophenyl)methyl]-1,7-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(S(=O)(=O)CC3CC3)n2C)n(Cc2ccccc2F)c1=O |
| InChI | InChI=1S/C18H19FN4O4S/c1-21-14-15(20-17(21)28(26,27)10-11-7-8-11)23(18(25)22(2)16(14)24)9-12-5-3-4-6-13(12)19/h3-6,11H,7-10H2,1-2H3 |
| InChIKey | PMWWYOQFPPBQIG-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 95.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 8-(cyclopropylmethylsulfonyl)-3-[(2-fluorophenyl)methyl]-1,7-dimethylpurine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(cyclopropylmethylsulfonyl)-3-[(2-fluorophenyl)methyl]-1,7-dimethylpurine-2,6-dione?
The IUPAC name of 8-(cyclopropylmethylsulfonyl)-3-[(2-fluorophenyl)methyl]-1,7-dimethylpurine-2,6-dione (CID 146283011) is 8-(cyclopropylmethylsulfonyl)-3-[(2-fluorophenyl)methyl]-1,7-dimethylpurine-2,6-dione.
What is the SMILES notation for 8-(cyclopropylmethylsulfonyl)-3-[(2-fluorophenyl)methyl]-1,7-dimethylpurine-2,6-dione?
The canonical SMILES for 8-(cyclopropylmethylsulfonyl)-3-[(2-fluorophenyl)methyl]-1,7-dimethylpurine-2,6-dione is Cn1c(=O)c2c(nc(S(=O)(=O)CC3CC3)n2C)n(Cc2ccccc2F)c1=O.
What is the InChIKey of 8-(cyclopropylmethylsulfonyl)-3-[(2-fluorophenyl)methyl]-1,7-dimethylpurine-2,6-dione?
The InChIKey is PMWWYOQFPPBQIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19FN4O4S/c1-21-14-15(20-17(21)28(26,27)10-11-7-8-11)23(18(25)22(2)16(14)24)9-12-5-3-4-6-13(12)19/h3-6,11H,7-10H2,1-2H3.
What are the key properties of 8-(cyclopropylmethylsulfonyl)-3-[(2-fluorophenyl)methyl]-1,7-dimethylpurine-2,6-dione?
8-(cyclopropylmethylsulfonyl)-3-[(2-fluorophenyl)methyl]-1,7-dimethylpurine-2,6-dione has a molecular weight of 406.44 g/mol, XLogP of 0.80, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(cyclopropylmethylsulfonyl)-3-[(2-fluorophenyl)methyl]-1,7-dimethylpurine-2,6-dione is sourced from PubChem (CID 146283011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).