About 5-[(3R)-1-iodopyrrolidin-3-yl]oxy-2,3-dimethylpyridine
5-[(3R)-1-iodopyrrolidin-3-yl]oxy-2,3-dimethylpyridine (PubChem CID 146283772) has the molecular formula C11H15IN2O
and a molecular weight of 318.16 g/mol. Its IUPAC name is 5-[(3R)-1-iodopyrrolidin-3-yl]oxy-2,3-dimethylpyridine.
Molecular Properties
| Compound Name | 5-[(3R)-1-iodopyrrolidin-3-yl]oxy-2,3-dimethylpyridine |
| PubChem CID | 146283772 |
| Molecular Formula | C11H15IN2O |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 5-[(3R)-1-iodopyrrolidin-3-yl]oxy-2,3-dimethylpyridine |
| SMILES | Cc1cc(O[C@@H]2CCN(I)C2)cnc1C |
| InChI | InChI=1S/C11H15IN2O/c1-8-5-11(6-13-9(8)2)15-10-3-4-14(12)7-10/h5-6,10H,3-4,7H2,1-2H3/t10-/m1/s1 |
| InChIKey | RWXLZSSBRQPHMI-SNVBAGLBSA-N |
| XLogP | 2.50 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 5-[(3R)-1-iodopyrrolidin-3-yl]oxy-2,3-dimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3R)-1-iodopyrrolidin-3-yl]oxy-2,3-dimethylpyridine?
The IUPAC name of 5-[(3R)-1-iodopyrrolidin-3-yl]oxy-2,3-dimethylpyridine (CID 146283772) is 5-[(3R)-1-iodopyrrolidin-3-yl]oxy-2,3-dimethylpyridine.
What is the SMILES notation for 5-[(3R)-1-iodopyrrolidin-3-yl]oxy-2,3-dimethylpyridine?
The canonical SMILES for 5-[(3R)-1-iodopyrrolidin-3-yl]oxy-2,3-dimethylpyridine is Cc1cc(O[C@@H]2CCN(I)C2)cnc1C.
What is the InChIKey of 5-[(3R)-1-iodopyrrolidin-3-yl]oxy-2,3-dimethylpyridine?
The InChIKey is RWXLZSSBRQPHMI-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H15IN2O/c1-8-5-11(6-13-9(8)2)15-10-3-4-14(12)7-10/h5-6,10H,3-4,7H2,1-2H3/t10-/m1/s1.
What are the key properties of 5-[(3R)-1-iodopyrrolidin-3-yl]oxy-2,3-dimethylpyridine?
5-[(3R)-1-iodopyrrolidin-3-yl]oxy-2,3-dimethylpyridine has a molecular weight of 318.16 g/mol, XLogP of 2.50, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3R)-1-iodopyrrolidin-3-yl]oxy-2,3-dimethylpyridine is sourced from PubChem (CID 146283772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).