C26H35N7O2S — CID 146284134
(5S)-2-(cyclopropanecarbonylamino)-N-(cyclopropylmethyl)-5-[3-[[(E)-4-methyliminohex-2-en-2-yl]amino]-1,2,4-triazol-4-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 146284134) has the molecular formula C26H35N7O2S and a molecular weight of 509.68 g/mol. Its IUPAC name is (5S)-2-(cyclopropanecarbonylamino)-N-(cyclopropylmethyl)-5-[3-[[(E)-4-methyliminohex-2-en-2-yl]amino]-1,2,4-triazol-4-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (5S)-2-(cyclopropanecarbonylamino)-N-(cyclopropylmethyl)-5-[3-[[(E)-4-methyliminohex-2-en-2-yl]amino]-1,2,4-triazol-4-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 146284134 |
| Molecular Formula | C26H35N7O2S |
| Molecular Weight | 509.68 g/mol |
| Exact Mass | 509.26 |
| IUPAC Name | (5S)-2-(cyclopropanecarbonylamino)-N-(cyclopropylmethyl)-5-[3-[[(E)-4-methyliminohex-2-en-2-yl]amino]-1,2,4-triazol-4-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CCC(/C=C(\C)Nc1nncn1[C@H]1CCc2sc(NC(=O)C3CC3)c(C(=O)NCC3CC3)c2C1)=N\C |
| InChI | InChI=1S/C26H35N7O2S/c1-4-18(27-3)11-15(2)30-26-32-29-14-33(26)19-9-10-21-20(12-19)22(24(35)28-13-16-5-6-16)25(36-21)31-23(34)17-7-8-17/h11,14,16-17,19H,4-10,12-13H2,1-3H3,(H,28,35)(H,30,32)(H,31,34)/b15-11+,27-18+/t19-/m0/s1 |
| InChIKey | JXXXEXYTIUUQHR-HLJZWIOESA-N |
| XLogP | 4.35 |
| TPSA | 113.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.68 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|