About N-(3-methoxy-1-methylpyrazol-5-yl)-3,3-dimethylbutanamide
N-(3-methoxy-1-methylpyrazol-5-yl)-3,3-dimethylbutanamide (PubChem CID 146284482) has the molecular formula C11H19N3O2
and a molecular weight of 225.29 g/mol. Its IUPAC name is N-(3-methoxy-1-methylpyrazol-5-yl)-3,3-dimethylbutanamide.
Molecular Properties
| Compound Name | N-(3-methoxy-1-methylpyrazol-5-yl)-3,3-dimethylbutanamide |
| PubChem CID | 146284482 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | N-(3-methoxy-1-methylpyrazol-5-yl)-3,3-dimethylbutanamide |
| SMILES | COc1cc(NC(=O)CC(C)(C)C)n(C)n1 |
| InChI | InChI=1S/C11H19N3O2/c1-11(2,3)7-9(15)12-8-6-10(16-5)13-14(8)4/h6H,7H2,1-5H3,(H,12,15) |
| InChIKey | FWIVYVOFKCDDHS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-methoxy-1-methylpyrazol-5-yl)-3,3-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methoxy-1-methylpyrazol-5-yl)-3,3-dimethylbutanamide?
The IUPAC name of N-(3-methoxy-1-methylpyrazol-5-yl)-3,3-dimethylbutanamide (CID 146284482) is N-(3-methoxy-1-methylpyrazol-5-yl)-3,3-dimethylbutanamide.
What is the SMILES notation for N-(3-methoxy-1-methylpyrazol-5-yl)-3,3-dimethylbutanamide?
The canonical SMILES for N-(3-methoxy-1-methylpyrazol-5-yl)-3,3-dimethylbutanamide is COc1cc(NC(=O)CC(C)(C)C)n(C)n1.
What is the InChIKey of N-(3-methoxy-1-methylpyrazol-5-yl)-3,3-dimethylbutanamide?
The InChIKey is FWIVYVOFKCDDHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O2/c1-11(2,3)7-9(15)12-8-6-10(16-5)13-14(8)4/h6H,7H2,1-5H3,(H,12,15).
What are the key properties of N-(3-methoxy-1-methylpyrazol-5-yl)-3,3-dimethylbutanamide?
N-(3-methoxy-1-methylpyrazol-5-yl)-3,3-dimethylbutanamide has a molecular weight of 225.29 g/mol, XLogP of 1.80, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methoxy-1-methylpyrazol-5-yl)-3,3-dimethylbutanamide is sourced from PubChem (CID 146284482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).